C13H17NO — CID 67166489
9-methyl-2,3,3a,4,5,10b-hexahydro-1H-[1]benzoxepino[4,5-c]pyrrole (PubChem CID 67166489) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 9-methyl-2,3,3a,4,5,10b-hexahydro-1H-[1]benzoxepino[4,5-c]pyrrole.
| Compound Name | 9-methyl-2,3,3a,4,5,10b-hexahydro-1H-[1]benzoxepino[4,5-c]pyrrole |
|---|---|
| PubChem CID | 67166489 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 9-methyl-2,3,3a,4,5,10b-hexahydro-1H-[1]benzoxepino[4,5-c]pyrrole |
| SMILES | Cc1ccc2c(c1)C1CNCC1CCO2 |
| InChI | InChI=1S/C13H17NO/c1-9-2-3-13-11(6-9)12-8-14-7-10(12)4-5-15-13/h2-3,6,10,12,14H,4-5,7-8H2,1H3 |
| InChIKey | XNZCQBBDSNIRFQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |