About 2-(fluoromethyl)-N',N'-dimethyl-5-nitrobenzenesulfonohydrazide
2-(fluoromethyl)-N',N'-dimethyl-5-nitrobenzenesulfonohydrazide (PubChem CID 67167184) has the molecular formula C9H12FN3O4S
and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-(fluoromethyl)-N',N'-dimethyl-5-nitrobenzenesulfonohydrazide.
Molecular Properties
| Compound Name | 2-(fluoromethyl)-N',N'-dimethyl-5-nitrobenzenesulfonohydrazide |
| PubChem CID | 67167184 |
| Molecular Formula | C9H12FN3O4S |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 2-(fluoromethyl)-N',N'-dimethyl-5-nitrobenzenesulfonohydrazide |
| SMILES | CN(C)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1CF |
| InChI | InChI=1S/C9H12FN3O4S/c1-12(2)11-18(16,17)9-5-8(13(14)15)4-3-7(9)6-10/h3-5,11H,6H2,1-2H3 |
| InChIKey | JVZUSOLGSPZHIV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(fluoromethyl)-N',N'-dimethyl-5-nitrobenzenesulfonohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(fluoromethyl)-N',N'-dimethyl-5-nitrobenzenesulfonohydrazide?
The IUPAC name of 2-(fluoromethyl)-N',N'-dimethyl-5-nitrobenzenesulfonohydrazide (CID 67167184) is 2-(fluoromethyl)-N',N'-dimethyl-5-nitrobenzenesulfonohydrazide.
What is the SMILES notation for 2-(fluoromethyl)-N',N'-dimethyl-5-nitrobenzenesulfonohydrazide?
The canonical SMILES for 2-(fluoromethyl)-N',N'-dimethyl-5-nitrobenzenesulfonohydrazide is CN(C)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1CF.
What is the InChIKey of 2-(fluoromethyl)-N',N'-dimethyl-5-nitrobenzenesulfonohydrazide?
The InChIKey is JVZUSOLGSPZHIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FN3O4S/c1-12(2)11-18(16,17)9-5-8(13(14)15)4-3-7(9)6-10/h3-5,11H,6H2,1-2H3.
What are the key properties of 2-(fluoromethyl)-N',N'-dimethyl-5-nitrobenzenesulfonohydrazide?
2-(fluoromethyl)-N',N'-dimethyl-5-nitrobenzenesulfonohydrazide has a molecular weight of 277.28 g/mol, XLogP of 0.82, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(fluoromethyl)-N',N'-dimethyl-5-nitrobenzenesulfonohydrazide is sourced from PubChem (CID 67167184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).