C17H18N2O — CID 67167529
7-pyridin-4-yl-2,3,3a,4,5,10b-hexahydro-1H-[1]benzoxepino[4,5-c]pyrrole (PubChem CID 67167529) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 7-pyridin-4-yl-2,3,3a,4,5,10b-hexahydro-1H-[1]benzoxepino[4,5-c]pyrrole.
| Compound Name | 7-pyridin-4-yl-2,3,3a,4,5,10b-hexahydro-1H-[1]benzoxepino[4,5-c]pyrrole |
|---|---|
| PubChem CID | 67167529 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 7-pyridin-4-yl-2,3,3a,4,5,10b-hexahydro-1H-[1]benzoxepino[4,5-c]pyrrole |
| SMILES | c1cc(-c2ccncc2)c2c(c1)C1CNCC1CCO2 |
| InChI | InChI=1S/C17H18N2O/c1-2-14(12-4-7-18-8-5-12)17-15(3-1)16-11-19-10-13(16)6-9-20-17/h1-5,7-8,13,16,19H,6,9-11H2 |
| InChIKey | NASRWYSSVWQVQR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |