C21H23N3O2 — CID 67167718
3-[(3aR,10bS)-6-oxo-2,3,3a,4,5,10b-hexahydro-1H-pyrrolo[3,4-d][2]benzazepin-8-yl]-N,N-dimethylbenzamide (PubChem CID 67167718) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 3-[(3aR,10bS)-6-oxo-2,3,3a,4,5,10b-hexahydro-1H-pyrrolo[3,4-d][2]benzazepin-8-yl]-N,N-dimethylbenzamide.
| Compound Name | 3-[(3aR,10bS)-6-oxo-2,3,3a,4,5,10b-hexahydro-1H-pyrrolo[3,4-d][2]benzazepin-8-yl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 67167718 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 3-[(3aR,10bS)-6-oxo-2,3,3a,4,5,10b-hexahydro-1H-pyrrolo[3,4-d][2]benzazepin-8-yl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(-c2ccc3c(c2)C(=O)NC[C@H]2CNC[C@H]32)c1 |
| InChI | InChI=1S/C21H23N3O2/c1-24(2)21(26)15-5-3-4-13(8-15)14-6-7-17-18(9-14)20(25)23-11-16-10-22-12-19(16)17/h3-9,16,19,22H,10-12H2,1-2H3,(H,23,25)/t16-,19+/m1/s1 |
| InChIKey | ZUFOZTUQMGYOBQ-APWZRJJASA-N |
| XLogP | 2.10 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |