C20H21BrO2S — CID 67168265
2-[(2E)-2-(3-bromopropylidene)-4-thiatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),5,11,13-pentaen-13-yl]butanoic acid (PubChem CID 67168265) has the molecular formula C20H21BrO2S and a molecular weight of 405.36 g/mol. Its IUPAC name is 2-[(2E)-2-(3-bromopropylidene)-4-thiatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),5,11,13-pentaen-13-yl]butanoic acid.
| Compound Name | 2-[(2E)-2-(3-bromopropylidene)-4-thiatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),5,11,13-pentaen-13-yl]butanoic acid |
|---|---|
| PubChem CID | 67168265 |
| Molecular Formula | C20H21BrO2S |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 2-[(2E)-2-(3-bromopropylidene)-4-thiatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),5,11,13-pentaen-13-yl]butanoic acid |
| SMILES | CCC(C(=O)O)c1ccc2c(c1)/C(=C\CCBr)c1sccc1CC2 |
| InChI | InChI=1S/C20H21BrO2S/c1-2-16(20(22)23)15-8-6-13-5-7-14-9-11-24-19(14)17(4-3-10-21)18(13)12-15/h4,6,8-9,11-12,16H,2-3,5,7,10H2,1H3,(H,22,23)/b17-4+ |
| InChIKey | RWRNTBQTEHIRCN-HAVNEIBRSA-N |
| XLogP | 5.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|