About 4-[3-(2,2,2-trifluoroethoxy)phenoxy]piperidine
4-[3-(2,2,2-trifluoroethoxy)phenoxy]piperidine (PubChem CID 67168614) has the molecular formula C13H16F3NO2
and a molecular weight of 275.27 g/mol. Its IUPAC name is 4-[3-(2,2,2-trifluoroethoxy)phenoxy]piperidine.
Molecular Properties
| Compound Name | 4-[3-(2,2,2-trifluoroethoxy)phenoxy]piperidine |
| PubChem CID | 67168614 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 4-[3-(2,2,2-trifluoroethoxy)phenoxy]piperidine |
| SMILES | FC(F)(F)COc1cccc(OC2CCNCC2)c1 |
| InChI | InChI=1S/C13H16F3NO2/c14-13(15,16)9-18-11-2-1-3-12(8-11)19-10-4-6-17-7-5-10/h1-3,8,10,17H,4-7,9H2 |
| InChIKey | MNRIYCSWWKSBCH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-(2,2,2-trifluoroethoxy)phenoxy]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,2,2-trifluoroethoxy)phenoxy]piperidine?
The IUPAC name of 4-[3-(2,2,2-trifluoroethoxy)phenoxy]piperidine (CID 67168614) is 4-[3-(2,2,2-trifluoroethoxy)phenoxy]piperidine.
What is the SMILES notation for 4-[3-(2,2,2-trifluoroethoxy)phenoxy]piperidine?
The canonical SMILES for 4-[3-(2,2,2-trifluoroethoxy)phenoxy]piperidine is FC(F)(F)COc1cccc(OC2CCNCC2)c1.
What is the InChIKey of 4-[3-(2,2,2-trifluoroethoxy)phenoxy]piperidine?
The InChIKey is MNRIYCSWWKSBCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3NO2/c14-13(15,16)9-18-11-2-1-3-12(8-11)19-10-4-6-17-7-5-10/h1-3,8,10,17H,4-7,9H2.
What are the key properties of 4-[3-(2,2,2-trifluoroethoxy)phenoxy]piperidine?
4-[3-(2,2,2-trifluoroethoxy)phenoxy]piperidine has a molecular weight of 275.27 g/mol, XLogP of 2.76, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,2,2-trifluoroethoxy)phenoxy]piperidine is sourced from PubChem (CID 67168614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).