About 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonamide
5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonamide (PubChem CID 67168985) has the molecular formula C9H14N2O5S2
and a molecular weight of 294.35 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonamide.
Molecular Properties
| Compound Name | 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonamide |
| PubChem CID | 67168985 |
| Molecular Formula | C9H14N2O5S2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonamide |
| SMILES | Cc1c(S(N)(=O)=O)cc(CCO)cc1S(N)(=O)=O |
| InChI | InChI=1S/C9H14N2O5S2/c1-6-8(17(10,13)14)4-7(2-3-12)5-9(6)18(11,15)16/h4-5,12H,2-3H2,1H3,(H2,10,13,14)(H2,11,15,16) |
| InChIKey | YWDRCZJYJHZFRX-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonamide?
The IUPAC name of 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonamide (CID 67168985) is 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonamide.
What is the SMILES notation for 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonamide?
The canonical SMILES for 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonamide is Cc1c(S(N)(=O)=O)cc(CCO)cc1S(N)(=O)=O.
What is the InChIKey of 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonamide?
The InChIKey is YWDRCZJYJHZFRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O5S2/c1-6-8(17(10,13)14)4-7(2-3-12)5-9(6)18(11,15)16/h4-5,12H,2-3H2,1H3,(H2,10,13,14)(H2,11,15,16).
What are the key properties of 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonamide?
5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonamide has a molecular weight of 294.35 g/mol, XLogP of -1.18, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonamide is sourced from PubChem (CID 67168985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).