About imidazo[4,5-e]indazole
imidazo[4,5-e]indazole (PubChem CID 67169610) has the molecular formula C8H4N4
and a molecular weight of 156.15 g/mol. Its IUPAC name is imidazo[4,5-e]indazole.
Molecular Properties
| Compound Name | imidazo[4,5-e]indazole |
| PubChem CID | 67169610 |
| Molecular Formula | C8H4N4 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | imidazo[4,5-e]indazole |
| SMILES | C1=NN=c2ccc3c(c21)N=CN=3 |
| InChI | InChI=1S/C8H4N4/c1-2-7-8(10-4-9-7)5-3-11-12-6(1)5/h1-4H |
| InChIKey | PTFYQSWHBLOXRZ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze imidazo[4,5-e]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[4,5-e]indazole?
The IUPAC name of imidazo[4,5-e]indazole (CID 67169610) is imidazo[4,5-e]indazole.
What is the SMILES notation for imidazo[4,5-e]indazole?
The canonical SMILES for imidazo[4,5-e]indazole is C1=NN=c2ccc3c(c21)N=CN=3.
What is the InChIKey of imidazo[4,5-e]indazole?
The InChIKey is PTFYQSWHBLOXRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N4/c1-2-7-8(10-4-9-7)5-3-11-12-6(1)5/h1-4H.
What are the key properties of imidazo[4,5-e]indazole?
imidazo[4,5-e]indazole has a molecular weight of 156.15 g/mol, XLogP of -0.05, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[4,5-e]indazole is sourced from PubChem (CID 67169610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).