C12H8N2O3S — CID 67169635
methyl 6-hydroxy-8-thia-4,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-5-carboxylate (PubChem CID 67169635) has the molecular formula C12H8N2O3S and a molecular weight of 260.27 g/mol. Its IUPAC name is methyl 6-hydroxy-8-thia-4,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-5-carboxylate.
| Compound Name | methyl 6-hydroxy-8-thia-4,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 67169635 |
| Molecular Formula | C12H8N2O3S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | methyl 6-hydroxy-8-thia-4,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-5-carboxylate |
| SMILES | COC(=O)c1ncc2c(sc3ncccc32)c1O |
| InChI | InChI=1S/C12H8N2O3S/c1-17-12(16)8-9(15)10-7(5-14-8)6-3-2-4-13-11(6)18-10/h2-5,15H,1H3 |
| InChIKey | SQAIXPFVHAZVDW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |