C19H20ClNO3 — CID 67170194
[4-(4-chlorophenoxy)piperidin-1-yl]-(3-hydroxy-4-methylphenyl)methanone (PubChem CID 67170194) has the molecular formula C19H20ClNO3 and a molecular weight of 345.83 g/mol. Its IUPAC name is [4-(4-chlorophenoxy)piperidin-1-yl]-(3-hydroxy-4-methylphenyl)methanone.
| Compound Name | [4-(4-chlorophenoxy)piperidin-1-yl]-(3-hydroxy-4-methylphenyl)methanone |
|---|---|
| PubChem CID | 67170194 |
| Molecular Formula | C19H20ClNO3 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | [4-(4-chlorophenoxy)piperidin-1-yl]-(3-hydroxy-4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCC(Oc3ccc(Cl)cc3)CC2)cc1O |
| InChI | InChI=1S/C19H20ClNO3/c1-13-2-3-14(12-18(13)22)19(23)21-10-8-17(9-11-21)24-16-6-4-15(20)5-7-16/h2-7,12,17,22H,8-11H2,1H3 |
| InChIKey | QMMOFHVFUUMVOR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |