About 2-ethyl-6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-3-one
2-ethyl-6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 67170418) has the molecular formula C8H10N4OS
and a molecular weight of 210.26 g/mol. Its IUPAC name is 2-ethyl-6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-3-one.
Molecular Properties
| Compound Name | 2-ethyl-6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-3-one |
| PubChem CID | 67170418 |
| Molecular Formula | C8H10N4OS |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 2-ethyl-6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | CCn1[nH]c2nc(SC)ncc2c1=O |
| InChI | InChI=1S/C8H10N4OS/c1-3-12-7(13)5-4-9-8(14-2)10-6(5)11-12/h4H,3H2,1-2H3,(H,9,10,11) |
| InChIKey | JBHPOUKJDKEXBY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-3-one?
The IUPAC name of 2-ethyl-6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-3-one (CID 67170418) is 2-ethyl-6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-3-one.
What is the SMILES notation for 2-ethyl-6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-3-one?
The canonical SMILES for 2-ethyl-6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-3-one is CCn1[nH]c2nc(SC)ncc2c1=O.
What is the InChIKey of 2-ethyl-6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-3-one?
The InChIKey is JBHPOUKJDKEXBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4OS/c1-3-12-7(13)5-4-9-8(14-2)10-6(5)11-12/h4H,3H2,1-2H3,(H,9,10,11).
What are the key properties of 2-ethyl-6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-3-one?
2-ethyl-6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-3-one has a molecular weight of 210.26 g/mol, XLogP of 0.86, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-3-one is sourced from PubChem (CID 67170418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).