C16H14F3NO3 — CID 67170839
1-(3,5-dimethyl-4-nitrophenyl)-2,2,2-trifluoro-1-phenylethanol (PubChem CID 67170839) has the molecular formula C16H14F3NO3 and a molecular weight of 325.29 g/mol. Its IUPAC name is 1-(3,5-dimethyl-4-nitrophenyl)-2,2,2-trifluoro-1-phenylethanol.
| Compound Name | 1-(3,5-dimethyl-4-nitrophenyl)-2,2,2-trifluoro-1-phenylethanol |
|---|---|
| PubChem CID | 67170839 |
| Molecular Formula | C16H14F3NO3 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 1-(3,5-dimethyl-4-nitrophenyl)-2,2,2-trifluoro-1-phenylethanol |
| SMILES | Cc1cc(C(O)(c2ccccc2)C(F)(F)F)cc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14F3NO3/c1-10-8-13(9-11(2)14(10)20(22)23)15(21,16(17,18)19)12-6-4-3-5-7-12/h3-9,21H,1-2H3 |
| InChIKey | BNUNVCUVAJVMHQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|