About bicyclo[4.1.0]hepta-1,3,5-triene;1H-quinolin-2-one
bicyclo[4.1.0]hepta-1,3,5-triene;1H-quinolin-2-one (PubChem CID 67171100) has the molecular formula C16H13NO
and a molecular weight of 235.29 g/mol. Its IUPAC name is bicyclo[4.1.0]hepta-1,3,5-triene;1H-quinolin-2-one.
Molecular Properties
| Compound Name | bicyclo[4.1.0]hepta-1,3,5-triene;1H-quinolin-2-one |
| PubChem CID | 67171100 |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | bicyclo[4.1.0]hepta-1,3,5-triene;1H-quinolin-2-one |
| SMILES | O=c1ccc2ccccc2[nH]1.c1ccc2c(c1)C2 |
| InChI | InChI=1S/C9H7NO.C7H6/c11-9-6-5-7-3-1-2-4-8(7)10-9;1-2-4-7-5-6(7)3-1/h1-6H,(H,10,11);1-4H,5H2 |
| InChIKey | VASFOMPHATVRHI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bicyclo[4.1.0]hepta-1,3,5-triene;1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[4.1.0]hepta-1,3,5-triene;1H-quinolin-2-one?
The IUPAC name of bicyclo[4.1.0]hepta-1,3,5-triene;1H-quinolin-2-one (CID 67171100) is bicyclo[4.1.0]hepta-1,3,5-triene;1H-quinolin-2-one.
What is the SMILES notation for bicyclo[4.1.0]hepta-1,3,5-triene;1H-quinolin-2-one?
The canonical SMILES for bicyclo[4.1.0]hepta-1,3,5-triene;1H-quinolin-2-one is O=c1ccc2ccccc2[nH]1.c1ccc2c(c1)C2.
What is the InChIKey of bicyclo[4.1.0]hepta-1,3,5-triene;1H-quinolin-2-one?
The InChIKey is VASFOMPHATVRHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.C7H6/c11-9-6-5-7-3-1-2-4-8(7)10-9;1-2-4-7-5-6(7)3-1/h1-6H,(H,10,11);1-4H,5H2.
What are the key properties of bicyclo[4.1.0]hepta-1,3,5-triene;1H-quinolin-2-one?
bicyclo[4.1.0]hepta-1,3,5-triene;1H-quinolin-2-one has a molecular weight of 235.29 g/mol, XLogP of 3.12, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[4.1.0]hepta-1,3,5-triene;1H-quinolin-2-one is sourced from PubChem (CID 67171100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).