C21H26N2O2S — CID 67171835
1-[(2-pentyl-4,5-dihydrobenzo[g][1,3]benzothiazol-7-yl)methyl]azetidine-3-carboxylic acid (PubChem CID 67171835) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is 1-[(2-pentyl-4,5-dihydrobenzo[g][1,3]benzothiazol-7-yl)methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[(2-pentyl-4,5-dihydrobenzo[g][1,3]benzothiazol-7-yl)methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 67171835 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-[(2-pentyl-4,5-dihydrobenzo[g][1,3]benzothiazol-7-yl)methyl]azetidine-3-carboxylic acid |
| SMILES | CCCCCc1nc2c(s1)-c1ccc(CN3CC(C(=O)O)C3)cc1CC2 |
| InChI | InChI=1S/C21H26N2O2S/c1-2-3-4-5-19-22-18-9-7-15-10-14(6-8-17(15)20(18)26-19)11-23-12-16(13-23)21(24)25/h6,8,10,16H,2-5,7,9,11-13H2,1H3,(H,24,25) |
| InChIKey | NFIREKBRJOMKHW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|