C22H32N2O4 — CID 67171905
tert-butyl N-[(7S)-2-[(4-methoxyphenyl)methyl]-1-oxo-2-azaspiro[4.5]decan-7-yl]carbamate (PubChem CID 67171905) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is tert-butyl N-[(7S)-2-[(4-methoxyphenyl)methyl]-1-oxo-2-azaspiro[4.5]decan-7-yl]carbamate.
| Compound Name | tert-butyl N-[(7S)-2-[(4-methoxyphenyl)methyl]-1-oxo-2-azaspiro[4.5]decan-7-yl]carbamate |
|---|---|
| PubChem CID | 67171905 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | tert-butyl N-[(7S)-2-[(4-methoxyphenyl)methyl]-1-oxo-2-azaspiro[4.5]decan-7-yl]carbamate |
| SMILES | COc1ccc(CN2CCC3(CCC[C@H](NC(=O)OC(C)(C)C)C3)C2=O)cc1 |
| InChI | InChI=1S/C22H32N2O4/c1-21(2,3)28-20(26)23-17-6-5-11-22(14-17)12-13-24(19(22)25)15-16-7-9-18(27-4)10-8-16/h7-10,17H,5-6,11-15H2,1-4H3,(H,23,26)/t17-,22?/m0/s1 |
| InChIKey | MPDCZNCVRYDMON-LBOXEOMUSA-N |
| XLogP | 3.88 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |