About 4-[1-(4-chlorophenyl)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]aniline
4-[1-(4-chlorophenyl)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]aniline (PubChem CID 67172414) has the molecular formula C17H19ClF3NOSi
and a molecular weight of 373.88 g/mol. Its IUPAC name is 4-[1-(4-chlorophenyl)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]aniline.
Molecular Properties
| Compound Name | 4-[1-(4-chlorophenyl)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]aniline |
| PubChem CID | 67172414 |
| Molecular Formula | C17H19ClF3NOSi |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 4-[1-(4-chlorophenyl)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]aniline |
| SMILES | C[Si](C)(C)OC(c1ccc(N)cc1)(c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C17H19ClF3NOSi/c1-24(2,3)23-16(17(19,20)21,12-4-8-14(18)9-5-12)13-6-10-15(22)11-7-13/h4-11H,22H2,1-3H3 |
| InChIKey | NIGOICWEJCJBCH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(4-chlorophenyl)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4-chlorophenyl)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]aniline?
The IUPAC name of 4-[1-(4-chlorophenyl)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]aniline (CID 67172414) is 4-[1-(4-chlorophenyl)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]aniline.
What is the SMILES notation for 4-[1-(4-chlorophenyl)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]aniline?
The canonical SMILES for 4-[1-(4-chlorophenyl)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]aniline is C[Si](C)(C)OC(c1ccc(N)cc1)(c1ccc(Cl)cc1)C(F)(F)F.
What is the InChIKey of 4-[1-(4-chlorophenyl)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]aniline?
The InChIKey is NIGOICWEJCJBCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19ClF3NOSi/c1-24(2,3)23-16(17(19,20)21,12-4-8-14(18)9-5-12)13-6-10-15(22)11-7-13/h4-11H,22H2,1-3H3.
What are the key properties of 4-[1-(4-chlorophenyl)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]aniline?
4-[1-(4-chlorophenyl)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]aniline has a molecular weight of 373.88 g/mol, XLogP of 5.58, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4-chlorophenyl)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]aniline is sourced from PubChem (CID 67172414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).