About N-[2-[5-(3,4-dichlorophenyl)furan-2-yl]ethyl]-1H-imidazole-5-carboxamide
N-[2-[5-(3,4-dichlorophenyl)furan-2-yl]ethyl]-1H-imidazole-5-carboxamide (PubChem CID 67172553) has the molecular formula C16H13Cl2N3O2
and a molecular weight of 350.21 g/mol. Its IUPAC name is N-[2-[5-(3,4-dichlorophenyl)furan-2-yl]ethyl]-1H-imidazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[2-[5-(3,4-dichlorophenyl)furan-2-yl]ethyl]-1H-imidazole-5-carboxamide |
| PubChem CID | 67172553 |
| Molecular Formula | C16H13Cl2N3O2 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | N-[2-[5-(3,4-dichlorophenyl)furan-2-yl]ethyl]-1H-imidazole-5-carboxamide |
| SMILES | O=C(NCCc1ccc(-c2ccc(Cl)c(Cl)c2)o1)c1cnc[nH]1 |
| InChI | InChI=1S/C16H13Cl2N3O2/c17-12-3-1-10(7-13(12)18)15-4-2-11(23-15)5-6-20-16(22)14-8-19-9-21-14/h1-4,7-9H,5-6H2,(H,19,21)(H,20,22) |
| InChIKey | PNORMOBCXGSGPR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-[5-(3,4-dichlorophenyl)furan-2-yl]ethyl]-1H-imidazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[5-(3,4-dichlorophenyl)furan-2-yl]ethyl]-1H-imidazole-5-carboxamide?
The IUPAC name of N-[2-[5-(3,4-dichlorophenyl)furan-2-yl]ethyl]-1H-imidazole-5-carboxamide (CID 67172553) is N-[2-[5-(3,4-dichlorophenyl)furan-2-yl]ethyl]-1H-imidazole-5-carboxamide.
What is the SMILES notation for N-[2-[5-(3,4-dichlorophenyl)furan-2-yl]ethyl]-1H-imidazole-5-carboxamide?
The canonical SMILES for N-[2-[5-(3,4-dichlorophenyl)furan-2-yl]ethyl]-1H-imidazole-5-carboxamide is O=C(NCCc1ccc(-c2ccc(Cl)c(Cl)c2)o1)c1cnc[nH]1.
What is the InChIKey of N-[2-[5-(3,4-dichlorophenyl)furan-2-yl]ethyl]-1H-imidazole-5-carboxamide?
The InChIKey is PNORMOBCXGSGPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13Cl2N3O2/c17-12-3-1-10(7-13(12)18)15-4-2-11(23-15)5-6-20-16(22)14-8-19-9-21-14/h1-4,7-9H,5-6H2,(H,19,21)(H,20,22).
What are the key properties of N-[2-[5-(3,4-dichlorophenyl)furan-2-yl]ethyl]-1H-imidazole-5-carboxamide?
N-[2-[5-(3,4-dichlorophenyl)furan-2-yl]ethyl]-1H-imidazole-5-carboxamide has a molecular weight of 350.21 g/mol, XLogP of 3.95, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[5-(3,4-dichlorophenyl)furan-2-yl]ethyl]-1H-imidazole-5-carboxamide is sourced from PubChem (CID 67172553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).