C25H24F3N5O5 — CID 67172634
N-[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyrazin-2-yl]-6-[3-(trifluoromethyl)phenyl]-2,3-dihydropyrido[3,2-b][1,4]oxazine-4-carboxamide (PubChem CID 67172634) has the molecular formula C25H24F3N5O5 and a molecular weight of 531.49 g/mol. Its IUPAC name is N-[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyrazin-2-yl]-6-[3-(trifluoromethyl)phenyl]-2,3-dihydropyrido[3,2-b][1,4]oxazine-4-carboxamide.
| Compound Name | N-[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyrazin-2-yl]-6-[3-(trifluoromethyl)phenyl]-2,3-dihydropyrido[3,2-b][1,4]oxazine-4-carboxamide |
|---|---|
| PubChem CID | 67172634 |
| Molecular Formula | C25H24F3N5O5 |
| Molecular Weight | 531.49 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | N-[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyrazin-2-yl]-6-[3-(trifluoromethyl)phenyl]-2,3-dihydropyrido[3,2-b][1,4]oxazine-4-carboxamide |
| SMILES | CC1(C)OCC(COc2cncc(NC(=O)N3CCOc4ccc(-c5cccc(C(F)(F)F)c5)nc43)n2)O1 |
| InChI | InChI=1S/C25H24F3N5O5/c1-24(2)37-14-17(38-24)13-36-21-12-29-11-20(31-21)32-23(34)33-8-9-35-19-7-6-18(30-22(19)33)15-4-3-5-16(10-15)25(26,27)28/h3-7,10-12,17H,8-9,13-14H2,1-2H3,(H,31,32,34) |
| InChIKey | ITILYVJRUGVFIC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |