C16H14N4O — CID 67172757
4-[2-(oxan-2-yl)pyrazol-3-yl]benzene-1,2-dicarbonitrile (PubChem CID 67172757) has the molecular formula C16H14N4O and a molecular weight of 278.32 g/mol. Its IUPAC name is 4-[2-(oxan-2-yl)pyrazol-3-yl]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[2-(oxan-2-yl)pyrazol-3-yl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 67172757 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 4-[2-(oxan-2-yl)pyrazol-3-yl]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(-c2ccnn2C2CCCCO2)cc1C#N |
| InChI | InChI=1S/C16H14N4O/c17-10-13-5-4-12(9-14(13)11-18)15-6-7-19-20(15)16-3-1-2-8-21-16/h4-7,9,16H,1-3,8H2 |
| InChIKey | JZMIHJSGYMZNAN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 74.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |