C12H27N3O9S2 — CID 67172844
(2S,3S)-2-amino-3-methyl-2-(2-morpholin-4-ylethyl)pentanamide;sulfo hydrogen sulfate (PubChem CID 67172844) has the molecular formula C12H27N3O9S2 and a molecular weight of 421.49 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-methyl-2-(2-morpholin-4-ylethyl)pentanamide;sulfo hydrogen sulfate.
| Compound Name | (2S,3S)-2-amino-3-methyl-2-(2-morpholin-4-ylethyl)pentanamide;sulfo hydrogen sulfate |
|---|---|
| PubChem CID | 67172844 |
| Molecular Formula | C12H27N3O9S2 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | (2S,3S)-2-amino-3-methyl-2-(2-morpholin-4-ylethyl)pentanamide;sulfo hydrogen sulfate |
| SMILES | CC[C@H](C)[C@@](N)(CCN1CCOCC1)C(N)=O.O=S(=O)(O)OS(=O)(=O)O |
| InChI | InChI=1S/C12H25N3O2.H2O7S2/c1-3-10(2)12(14,11(13)16)4-5-15-6-8-17-9-7-15;1-8(2,3)7-9(4,5)6/h10H,3-9,14H2,1-2H3,(H2,13,16);(H,1,2,3)(H,4,5,6)/t10-,12-;/m0./s1 |
| InChIKey | MKEKLEKKQVDYEX-JGAZGGJJSA-N |
| XLogP | -1.45 |
| TPSA | 199.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|