C17H20INO6 — CID 6717295
(1S,5S,6S)-N-(2-hydroxyethyl)-5-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxamide (PubChem CID 6717295) has the molecular formula C17H20INO6 and a molecular weight of 461.25 g/mol. Its IUPAC name is (1S,5S,6S)-N-(2-hydroxyethyl)-5-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxamide.
| Compound Name | (1S,5S,6S)-N-(2-hydroxyethyl)-5-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 6717295 |
| Molecular Formula | C17H20INO6 |
| Molecular Weight | 461.25 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | (1S,5S,6S)-N-(2-hydroxyethyl)-5-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxamide |
| SMILES | COc1cc(CO)cc(I)c1O[C@H]1C=C(C(=O)NCCO)C[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C17H20INO6/c1-23-12-5-9(8-21)4-11(18)15(12)24-13-6-10(7-14-16(13)25-14)17(22)19-2-3-20/h4-6,13-14,16,20-21H,2-3,7-8H2,1H3,(H,19,22)/t13-,14-,16+/m0/s1 |
| InChIKey | WEOYOXXTGGIYIO-OFQRWUPVSA-N |
| XLogP | 0.75 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|