C17H19F2NO6 — CID 67173021
(2S,4S)-1-[(1R)-1-acetyloxyethoxy]carbonyl-4-[(2,3-difluorophenyl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 67173021) has the molecular formula C17H19F2NO6 and a molecular weight of 371.34 g/mol. Its IUPAC name is (2S,4S)-1-[(1R)-1-acetyloxyethoxy]carbonyl-4-[(2,3-difluorophenyl)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-1-[(1R)-1-acetyloxyethoxy]carbonyl-4-[(2,3-difluorophenyl)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67173021 |
| Molecular Formula | C17H19F2NO6 |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | (2S,4S)-1-[(1R)-1-acetyloxyethoxy]carbonyl-4-[(2,3-difluorophenyl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(=O)O[C@@H](C)OC(=O)N1C[C@@H](Cc2cccc(F)c2F)C[C@H]1C(=O)O |
| InChI | InChI=1S/C17H19F2NO6/c1-9(21)25-10(2)26-17(24)20-8-11(7-14(20)16(22)23)6-12-4-3-5-13(18)15(12)19/h3-5,10-11,14H,6-8H2,1-2H3,(H,22,23)/t10-,11+,14+/m1/s1 |
| InChIKey | MAXDQQBLTPFAAO-SUNKGSAMSA-N |
| XLogP | 2.33 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|