C20H12ClFN4O2 — CID 67173069
2-(5-chloro-2-fluorophenyl)-N-(3-nitro-4-pyridinyl)quinolin-4-amine (PubChem CID 67173069) has the molecular formula C20H12ClFN4O2 and a molecular weight of 394.79 g/mol. Its IUPAC name is 2-(5-chloro-2-fluorophenyl)-N-(3-nitro-4-pyridinyl)quinolin-4-amine.
| Compound Name | 2-(5-chloro-2-fluorophenyl)-N-(3-nitro-4-pyridinyl)quinolin-4-amine |
|---|---|
| PubChem CID | 67173069 |
| Molecular Formula | C20H12ClFN4O2 |
| Molecular Weight | 394.79 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 2-(5-chloro-2-fluorophenyl)-N-(3-nitro-4-pyridinyl)quinolin-4-amine |
| SMILES | O=[N+]([O-])c1cnccc1Nc1cc(-c2cc(Cl)ccc2F)nc2ccccc12 |
| InChI | InChI=1S/C20H12ClFN4O2/c21-12-5-6-15(22)14(9-12)19-10-18(13-3-1-2-4-16(13)24-19)25-17-7-8-23-11-20(17)26(27)28/h1-11H,(H,23,24,25) |
| InChIKey | PLTHSLCJBCJLDL-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.79 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|