C21H23ClN2O2S — CID 67173175
5-(benzenesulfonyl)-9-methyl-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraene;hydrochloride (PubChem CID 67173175) has the molecular formula C21H23ClN2O2S and a molecular weight of 402.95 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-9-methyl-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraene;hydrochloride.
| Compound Name | 5-(benzenesulfonyl)-9-methyl-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraene;hydrochloride |
|---|---|
| PubChem CID | 67173175 |
| Molecular Formula | C21H23ClN2O2S |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 5-(benzenesulfonyl)-9-methyl-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraene;hydrochloride |
| SMILES | Cl.Cn1c2c(c3cc(S(=O)(=O)c4ccccc4)ccc31)C1CCCC(C2)N1 |
| InChI | InChI=1S/C21H22N2O2S.ClH/c1-23-19-11-10-16(26(24,25)15-7-3-2-4-8-15)13-17(19)21-18-9-5-6-14(22-18)12-20(21)23;/h2-4,7-8,10-11,13-14,18,22H,5-6,9,12H2,1H3;1H |
| InChIKey | AQYSMLZQYYYMEU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|