C25H37NO3S2 — CID 67173411
2-(3-thiophen-2-ylpropanoylamino)-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid (PubChem CID 67173411) has the molecular formula C25H37NO3S2 and a molecular weight of 463.71 g/mol. Its IUPAC name is 2-(3-thiophen-2-ylpropanoylamino)-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid.
| Compound Name | 2-(3-thiophen-2-ylpropanoylamino)-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 67173411 |
| Molecular Formula | C25H37NO3S2 |
| Molecular Weight | 463.71 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 2-(3-thiophen-2-ylpropanoylamino)-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCSCC(NC(=O)CCc1cccs1)C(=O)O |
| InChI | InChI=1S/C25H37NO3S2/c1-19(2)8-5-9-20(3)10-6-11-21(4)15-17-30-18-23(25(28)29)26-24(27)14-13-22-12-7-16-31-22/h7-8,10,12,15-16,23H,5-6,9,11,13-14,17-18H2,1-4H3,(H,26,27)(H,28,29) |
| InChIKey | DQMFBOHGFYAQBL-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.71 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|