C18H20N4 — CID 67173481
1,4-bis(4-methyl-2-pyridinyl)cyclohexa-3,5-diene-1,2-diamine (PubChem CID 67173481) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is 1,4-bis(4-methyl-2-pyridinyl)cyclohexa-3,5-diene-1,2-diamine.
| Compound Name | 1,4-bis(4-methyl-2-pyridinyl)cyclohexa-3,5-diene-1,2-diamine |
|---|---|
| PubChem CID | 67173481 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 1,4-bis(4-methyl-2-pyridinyl)cyclohexa-3,5-diene-1,2-diamine |
| SMILES | Cc1ccnc(C2=CC(N)C(N)(c3cc(C)ccn3)C=C2)c1 |
| InChI | InChI=1S/C18H20N4/c1-12-4-7-21-15(9-12)14-3-6-18(20,16(19)11-14)17-10-13(2)5-8-22-17/h3-11,16H,19-20H2,1-2H3 |
| InChIKey | HQSGOPXRVIVEMD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |