C17H18N4O3 — CID 67174218
(2E)-1-cyclopropyl-2-(ethoxymethylidene)-3-[2-methyl-6-(1,2,4-triazol-1-yl)-3-pyridinyl]propane-1,3-dione (PubChem CID 67174218) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is (2E)-1-cyclopropyl-2-(ethoxymethylidene)-3-[2-methyl-6-(1,2,4-triazol-1-yl)-3-pyridinyl]propane-1,3-dione.
| Compound Name | (2E)-1-cyclopropyl-2-(ethoxymethylidene)-3-[2-methyl-6-(1,2,4-triazol-1-yl)-3-pyridinyl]propane-1,3-dione |
|---|---|
| PubChem CID | 67174218 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (2E)-1-cyclopropyl-2-(ethoxymethylidene)-3-[2-methyl-6-(1,2,4-triazol-1-yl)-3-pyridinyl]propane-1,3-dione |
| SMILES | CCO/C=C(/C(=O)c1ccc(-n2cncn2)nc1C)C(=O)C1CC1 |
| InChI | InChI=1S/C17H18N4O3/c1-3-24-8-14(16(22)12-4-5-12)17(23)13-6-7-15(20-11(13)2)21-10-18-9-19-21/h6-10,12H,3-5H2,1-2H3/b14-8+ |
| InChIKey | WOAZFDODBHXLSR-RIYZIHGNSA-N |
| XLogP | 2.05 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|