C20H16O2S — CID 67174329
3-(4,5-diphenylthiophen-2-yl)-2-methylprop-2-enoic acid (PubChem CID 67174329) has the molecular formula C20H16O2S and a molecular weight of 320.41 g/mol. Its IUPAC name is 3-(4,5-diphenylthiophen-2-yl)-2-methylprop-2-enoic acid.
| Compound Name | 3-(4,5-diphenylthiophen-2-yl)-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 67174329 |
| Molecular Formula | C20H16O2S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 3-(4,5-diphenylthiophen-2-yl)-2-methylprop-2-enoic acid |
| SMILES | CC(=Cc1cc(-c2ccccc2)c(-c2ccccc2)s1)C(=O)O |
| InChI | InChI=1S/C20H16O2S/c1-14(20(21)22)12-17-13-18(15-8-4-2-5-9-15)19(23-17)16-10-6-3-7-11-16/h2-13H,1H3,(H,21,22) |
| InChIKey | DEBDJQDSWAKXSF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|