About 2-ethyl-2'-ethylsulfanyl-2-phenylspiro[3H-chromene-4,4'-imidazole]
2-ethyl-2'-ethylsulfanyl-2-phenylspiro[3H-chromene-4,4'-imidazole] (PubChem CID 67174362) has the molecular formula C21H22N2OS
and a molecular weight of 350.49 g/mol. Its IUPAC name is 2-ethyl-2'-ethylsulfanyl-2-phenylspiro[3H-chromene-4,4'-imidazole].
Molecular Properties
| Compound Name | 2-ethyl-2'-ethylsulfanyl-2-phenylspiro[3H-chromene-4,4'-imidazole] |
| PubChem CID | 67174362 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-ethyl-2'-ethylsulfanyl-2-phenylspiro[3H-chromene-4,4'-imidazole] |
| SMILES | CCSC1=NC2(C=N1)CC(CC)(c1ccccc1)Oc1ccccc12 |
| InChI | InChI=1S/C21H22N2OS/c1-3-21(16-10-6-5-7-11-16)14-20(15-22-19(23-20)25-4-2)17-12-8-9-13-18(17)24-21/h5-13,15H,3-4,14H2,1-2H3 |
| InChIKey | BJFKTYAKCMSSTA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-2'-ethylsulfanyl-2-phenylspiro[3H-chromene-4,4'-imidazole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2'-ethylsulfanyl-2-phenylspiro[3H-chromene-4,4'-imidazole]?
The IUPAC name of 2-ethyl-2'-ethylsulfanyl-2-phenylspiro[3H-chromene-4,4'-imidazole] (CID 67174362) is 2-ethyl-2'-ethylsulfanyl-2-phenylspiro[3H-chromene-4,4'-imidazole].
What is the SMILES notation for 2-ethyl-2'-ethylsulfanyl-2-phenylspiro[3H-chromene-4,4'-imidazole]?
The canonical SMILES for 2-ethyl-2'-ethylsulfanyl-2-phenylspiro[3H-chromene-4,4'-imidazole] is CCSC1=NC2(C=N1)CC(CC)(c1ccccc1)Oc1ccccc12.
What is the InChIKey of 2-ethyl-2'-ethylsulfanyl-2-phenylspiro[3H-chromene-4,4'-imidazole]?
The InChIKey is BJFKTYAKCMSSTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2OS/c1-3-21(16-10-6-5-7-11-16)14-20(15-22-19(23-20)25-4-2)17-12-8-9-13-18(17)24-21/h5-13,15H,3-4,14H2,1-2H3.
What are the key properties of 2-ethyl-2'-ethylsulfanyl-2-phenylspiro[3H-chromene-4,4'-imidazole]?
2-ethyl-2'-ethylsulfanyl-2-phenylspiro[3H-chromene-4,4'-imidazole] has a molecular weight of 350.49 g/mol, XLogP of 5.16, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2'-ethylsulfanyl-2-phenylspiro[3H-chromene-4,4'-imidazole] is sourced from PubChem (CID 67174362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).