About 1-adamantyl 7-methoxy-2-methylhept-2-enoate
1-adamantyl 7-methoxy-2-methylhept-2-enoate (PubChem CID 67174955) has the molecular formula C19H30O3
and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-adamantyl 7-methoxy-2-methylhept-2-enoate.
Molecular Properties
| Compound Name | 1-adamantyl 7-methoxy-2-methylhept-2-enoate |
| PubChem CID | 67174955 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 1-adamantyl 7-methoxy-2-methylhept-2-enoate |
| SMILES | COCCCCC=C(C)C(=O)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H30O3/c1-14(6-4-3-5-7-21-2)18(20)22-19-11-15-8-16(12-19)10-17(9-15)13-19/h6,15-17H,3-5,7-13H2,1-2H3 |
| InChIKey | CDONCLPOLZNXRU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-adamantyl 7-methoxy-2-methylhept-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyl 7-methoxy-2-methylhept-2-enoate?
The IUPAC name of 1-adamantyl 7-methoxy-2-methylhept-2-enoate (CID 67174955) is 1-adamantyl 7-methoxy-2-methylhept-2-enoate.
What is the SMILES notation for 1-adamantyl 7-methoxy-2-methylhept-2-enoate?
The canonical SMILES for 1-adamantyl 7-methoxy-2-methylhept-2-enoate is COCCCCC=C(C)C(=O)OC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-adamantyl 7-methoxy-2-methylhept-2-enoate?
The InChIKey is CDONCLPOLZNXRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O3/c1-14(6-4-3-5-7-21-2)18(20)22-19-11-15-8-16(12-19)10-17(9-15)13-19/h6,15-17H,3-5,7-13H2,1-2H3.
What are the key properties of 1-adamantyl 7-methoxy-2-methylhept-2-enoate?
1-adamantyl 7-methoxy-2-methylhept-2-enoate has a molecular weight of 306.45 g/mol, XLogP of 4.26, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyl 7-methoxy-2-methylhept-2-enoate is sourced from PubChem (CID 67174955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).