About spiro[1,2-dihydroindole-3,4'-thiane]
spiro[1,2-dihydroindole-3,4'-thiane] (PubChem CID 67174962) has the molecular formula C12H15NS
and a molecular weight of 205.33 g/mol. Its IUPAC name is spiro[1,2-dihydroindole-3,4'-thiane].
Molecular Properties
| Compound Name | spiro[1,2-dihydroindole-3,4'-thiane] |
| PubChem CID | 67174962 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | spiro[1,2-dihydroindole-3,4'-thiane] |
| SMILES | c1ccc2c(c1)NCC21CCSCC1 |
| InChI | InChI=1S/C12H15NS/c1-2-4-11-10(3-1)12(9-13-11)5-7-14-8-6-12/h1-4,13H,5-9H2 |
| InChIKey | QPYIXENSNVGWNM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[1,2-dihydroindole-3,4'-thiane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,2-dihydroindole-3,4'-thiane]?
The IUPAC name of spiro[1,2-dihydroindole-3,4'-thiane] (CID 67174962) is spiro[1,2-dihydroindole-3,4'-thiane].
What is the SMILES notation for spiro[1,2-dihydroindole-3,4'-thiane]?
The canonical SMILES for spiro[1,2-dihydroindole-3,4'-thiane] is c1ccc2c(c1)NCC21CCSCC1.
What is the InChIKey of spiro[1,2-dihydroindole-3,4'-thiane]?
The InChIKey is QPYIXENSNVGWNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NS/c1-2-4-11-10(3-1)12(9-13-11)5-7-14-8-6-12/h1-4,13H,5-9H2.
What are the key properties of spiro[1,2-dihydroindole-3,4'-thiane]?
spiro[1,2-dihydroindole-3,4'-thiane] has a molecular weight of 205.33 g/mol, XLogP of 2.88, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,2-dihydroindole-3,4'-thiane] is sourced from PubChem (CID 67174962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).