About ethyl 3-[5-(1,3-benzothiazol-6-yl)-1-(4-carbamoyl-2-methylphenyl)pyrrol-2-yl]propanoate
ethyl 3-[5-(1,3-benzothiazol-6-yl)-1-(4-carbamoyl-2-methylphenyl)pyrrol-2-yl]propanoate (PubChem CID 67175141) has the molecular formula C24H23N3O3S
and a molecular weight of 433.53 g/mol. Its IUPAC name is ethyl 3-[5-(1,3-benzothiazol-6-yl)-1-(4-carbamoyl-2-methylphenyl)pyrrol-2-yl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[5-(1,3-benzothiazol-6-yl)-1-(4-carbamoyl-2-methylphenyl)pyrrol-2-yl]propanoate |
| PubChem CID | 67175141 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | ethyl 3-[5-(1,3-benzothiazol-6-yl)-1-(4-carbamoyl-2-methylphenyl)pyrrol-2-yl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(-c2ccc3ncsc3c2)n1-c1ccc(C(N)=O)cc1C |
| InChI | InChI=1S/C24H23N3O3S/c1-3-30-23(28)11-7-18-6-10-21(16-4-8-19-22(13-16)31-14-26-19)27(18)20-9-5-17(24(25)29)12-15(20)2/h4-6,8-10,12-14H,3,7,11H2,1-2H3,(H2,25,29) |
| InChIKey | FVJAHNRDOVDYTQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[5-(1,3-benzothiazol-6-yl)-1-(4-carbamoyl-2-methylphenyl)pyrrol-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[5-(1,3-benzothiazol-6-yl)-1-(4-carbamoyl-2-methylphenyl)pyrrol-2-yl]propanoate?
The IUPAC name of ethyl 3-[5-(1,3-benzothiazol-6-yl)-1-(4-carbamoyl-2-methylphenyl)pyrrol-2-yl]propanoate (CID 67175141) is ethyl 3-[5-(1,3-benzothiazol-6-yl)-1-(4-carbamoyl-2-methylphenyl)pyrrol-2-yl]propanoate.
What is the SMILES notation for ethyl 3-[5-(1,3-benzothiazol-6-yl)-1-(4-carbamoyl-2-methylphenyl)pyrrol-2-yl]propanoate?
The canonical SMILES for ethyl 3-[5-(1,3-benzothiazol-6-yl)-1-(4-carbamoyl-2-methylphenyl)pyrrol-2-yl]propanoate is CCOC(=O)CCc1ccc(-c2ccc3ncsc3c2)n1-c1ccc(C(N)=O)cc1C.
What is the InChIKey of ethyl 3-[5-(1,3-benzothiazol-6-yl)-1-(4-carbamoyl-2-methylphenyl)pyrrol-2-yl]propanoate?
The InChIKey is FVJAHNRDOVDYTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23N3O3S/c1-3-30-23(28)11-7-18-6-10-21(16-4-8-19-22(13-16)31-14-26-19)27(18)20-9-5-17(24(25)29)12-15(20)2/h4-6,8-10,12-14H,3,7,11H2,1-2H3,(H2,25,29).
What are the key properties of ethyl 3-[5-(1,3-benzothiazol-6-yl)-1-(4-carbamoyl-2-methylphenyl)pyrrol-2-yl]propanoate?
ethyl 3-[5-(1,3-benzothiazol-6-yl)-1-(4-carbamoyl-2-methylphenyl)pyrrol-2-yl]propanoate has a molecular weight of 433.53 g/mol, XLogP of 4.66, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[5-(1,3-benzothiazol-6-yl)-1-(4-carbamoyl-2-methylphenyl)pyrrol-2-yl]propanoate is sourced from PubChem (CID 67175141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).