About 2-methylidene-4,8-dioxaspiro[2.5]octane
2-methylidene-4,8-dioxaspiro[2.5]octane (PubChem CID 67175350) has the molecular formula C7H10O2
and a molecular weight of 126.16 g/mol. Its IUPAC name is 2-methylidene-4,8-dioxaspiro[2.5]octane.
Molecular Properties
| Compound Name | 2-methylidene-4,8-dioxaspiro[2.5]octane |
| PubChem CID | 67175350 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 2-methylidene-4,8-dioxaspiro[2.5]octane |
| SMILES | C=C1CC12OCCCO2 |
| InChI | InChI=1S/C7H10O2/c1-6-5-7(6)8-3-2-4-9-7/h1-5H2 |
| InChIKey | KGWFCOWLSCUIGF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidene-4,8-dioxaspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-4,8-dioxaspiro[2.5]octane?
The IUPAC name of 2-methylidene-4,8-dioxaspiro[2.5]octane (CID 67175350) is 2-methylidene-4,8-dioxaspiro[2.5]octane.
What is the SMILES notation for 2-methylidene-4,8-dioxaspiro[2.5]octane?
The canonical SMILES for 2-methylidene-4,8-dioxaspiro[2.5]octane is C=C1CC12OCCCO2.
What is the InChIKey of 2-methylidene-4,8-dioxaspiro[2.5]octane?
The InChIKey is KGWFCOWLSCUIGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c1-6-5-7(6)8-3-2-4-9-7/h1-5H2.
What are the key properties of 2-methylidene-4,8-dioxaspiro[2.5]octane?
2-methylidene-4,8-dioxaspiro[2.5]octane has a molecular weight of 126.16 g/mol, XLogP of 1.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-4,8-dioxaspiro[2.5]octane is sourced from PubChem (CID 67175350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).