C28H37N5O5S2 — CID 67175916
5-[2,1,3-benzothiadiazol-4-ylsulfonyl(hexyl)amino]-3-[2-(diethylamino)ethoxy]-2-methylindole-1-carboxylic acid (PubChem CID 67175916) has the molecular formula C28H37N5O5S2 and a molecular weight of 587.77 g/mol. Its IUPAC name is 5-[2,1,3-benzothiadiazol-4-ylsulfonyl(hexyl)amino]-3-[2-(diethylamino)ethoxy]-2-methylindole-1-carboxylic acid.
| Compound Name | 5-[2,1,3-benzothiadiazol-4-ylsulfonyl(hexyl)amino]-3-[2-(diethylamino)ethoxy]-2-methylindole-1-carboxylic acid |
|---|---|
| PubChem CID | 67175916 |
| Molecular Formula | C28H37N5O5S2 |
| Molecular Weight | 587.77 g/mol |
| Exact Mass | 587.22 |
| IUPAC Name | 5-[2,1,3-benzothiadiazol-4-ylsulfonyl(hexyl)amino]-3-[2-(diethylamino)ethoxy]-2-methylindole-1-carboxylic acid |
| SMILES | CCCCCCN(c1ccc2c(c1)c(OCCN(CC)CC)c(C)n2C(=O)O)S(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C28H37N5O5S2/c1-5-8-9-10-16-32(40(36,37)25-13-11-12-23-26(25)30-39-29-23)21-14-15-24-22(19-21)27(20(4)33(24)28(34)35)38-18-17-31(6-2)7-3/h11-15,19H,5-10,16-18H2,1-4H3,(H,34,35) |
| InChIKey | OVQFUIABXGAJTF-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.77 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|