About 1-nitroso-2-phenyl-4H-imidazo[1,2-a]benzimidazole
1-nitroso-2-phenyl-4H-imidazo[1,2-a]benzimidazole (PubChem CID 671760) has the molecular formula C15H10N4O
and a molecular weight of 262.27 g/mol. Its IUPAC name is 1-nitroso-2-phenyl-4H-imidazo[1,2-a]benzimidazole.
Molecular Properties
| Compound Name | 1-nitroso-2-phenyl-4H-imidazo[1,2-a]benzimidazole |
| PubChem CID | 671760 |
| Molecular Formula | C15H10N4O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 1-nitroso-2-phenyl-4H-imidazo[1,2-a]benzimidazole |
| SMILES | O=Nc1c(-c2ccccc2)nc2[nH]c3ccccc3n12 |
| InChI | InChI=1S/C15H10N4O/c20-18-14-13(10-6-2-1-3-7-10)17-15-16-11-8-4-5-9-12(11)19(14)15/h1-9H,(H,16,17) |
| InChIKey | LDVGUHRRBLCBSP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-nitroso-2-phenyl-4H-imidazo[1,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitroso-2-phenyl-4H-imidazo[1,2-a]benzimidazole?
The IUPAC name of 1-nitroso-2-phenyl-4H-imidazo[1,2-a]benzimidazole (CID 671760) is 1-nitroso-2-phenyl-4H-imidazo[1,2-a]benzimidazole.
What is the SMILES notation for 1-nitroso-2-phenyl-4H-imidazo[1,2-a]benzimidazole?
The canonical SMILES for 1-nitroso-2-phenyl-4H-imidazo[1,2-a]benzimidazole is O=Nc1c(-c2ccccc2)nc2[nH]c3ccccc3n12.
What is the InChIKey of 1-nitroso-2-phenyl-4H-imidazo[1,2-a]benzimidazole?
The InChIKey is LDVGUHRRBLCBSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N4O/c20-18-14-13(10-6-2-1-3-7-10)17-15-16-11-8-4-5-9-12(11)19(14)15/h1-9H,(H,16,17).
What are the key properties of 1-nitroso-2-phenyl-4H-imidazo[1,2-a]benzimidazole?
1-nitroso-2-phenyl-4H-imidazo[1,2-a]benzimidazole has a molecular weight of 262.27 g/mol, XLogP of 3.88, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitroso-2-phenyl-4H-imidazo[1,2-a]benzimidazole is sourced from PubChem (CID 671760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).