C26H38BBrO6 — CID 67176153
1-bromo-3-(3-methoxypropoxy)benzene;2-[3-(3-methoxypropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 67176153) has the molecular formula C26H38BBrO6 and a molecular weight of 537.30 g/mol. Its IUPAC name is 1-bromo-3-(3-methoxypropoxy)benzene;2-[3-(3-methoxypropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 1-bromo-3-(3-methoxypropoxy)benzene;2-[3-(3-methoxypropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 67176153 |
| Molecular Formula | C26H38BBrO6 |
| Molecular Weight | 537.30 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | 1-bromo-3-(3-methoxypropoxy)benzene;2-[3-(3-methoxypropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COCCCOc1cccc(B2OC(C)(C)C(C)(C)O2)c1.COCCCOc1cccc(Br)c1 |
| InChI | InChI=1S/C16H25BO4.C10H13BrO2/c1-15(2)16(3,4)21-17(20-15)13-8-6-9-14(12-13)19-11-7-10-18-5;1-12-6-3-7-13-10-5-2-4-9(11)8-10/h6,8-9,12H,7,10-11H2,1-5H3;2,4-5,8H,3,6-7H2,1H3 |
| InChIKey | WETBBYHKWKYQDR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.30 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|