About 1,3-diethyl-2-methyl-2,4-dihydropyrimidine
1,3-diethyl-2-methyl-2,4-dihydropyrimidine (PubChem CID 67177121) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 1,3-diethyl-2-methyl-2,4-dihydropyrimidine.
Molecular Properties
| Compound Name | 1,3-diethyl-2-methyl-2,4-dihydropyrimidine |
| PubChem CID | 67177121 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 1,3-diethyl-2-methyl-2,4-dihydropyrimidine |
| SMILES | CCN1C=CCN(CC)C1C |
| InChI | InChI=1S/C9H18N2/c1-4-10-7-6-8-11(5-2)9(10)3/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | ANBYYLUWODPPRE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-diethyl-2-methyl-2,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethyl-2-methyl-2,4-dihydropyrimidine?
The IUPAC name of 1,3-diethyl-2-methyl-2,4-dihydropyrimidine (CID 67177121) is 1,3-diethyl-2-methyl-2,4-dihydropyrimidine.
What is the SMILES notation for 1,3-diethyl-2-methyl-2,4-dihydropyrimidine?
The canonical SMILES for 1,3-diethyl-2-methyl-2,4-dihydropyrimidine is CCN1C=CCN(CC)C1C.
What is the InChIKey of 1,3-diethyl-2-methyl-2,4-dihydropyrimidine?
The InChIKey is ANBYYLUWODPPRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-4-10-7-6-8-11(5-2)9(10)3/h6-7,9H,4-5,8H2,1-3H3.
What are the key properties of 1,3-diethyl-2-methyl-2,4-dihydropyrimidine?
1,3-diethyl-2-methyl-2,4-dihydropyrimidine has a molecular weight of 154.26 g/mol, XLogP of 1.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-2-methyl-2,4-dihydropyrimidine is sourced from PubChem (CID 67177121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).