C27H36N4O — CID 67177456
[6-(1-aminoethyl)-2-pyridinyl]-[2-[(3-phenylpyrrolidin-1-yl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]methanone (PubChem CID 67177456) has the molecular formula C27H36N4O and a molecular weight of 432.61 g/mol. Its IUPAC name is [6-(1-aminoethyl)-2-pyridinyl]-[2-[(3-phenylpyrrolidin-1-yl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]methanone.
| Compound Name | [6-(1-aminoethyl)-2-pyridinyl]-[2-[(3-phenylpyrrolidin-1-yl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]methanone |
|---|---|
| PubChem CID | 67177456 |
| Molecular Formula | C27H36N4O |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | [6-(1-aminoethyl)-2-pyridinyl]-[2-[(3-phenylpyrrolidin-1-yl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]methanone |
| SMILES | CC(N)c1cccc(C(=O)N2C(CN3CCC(c4ccccc4)C3)CC3CCCCC32)n1 |
| InChI | InChI=1S/C27H36N4O/c1-19(28)24-11-7-12-25(29-24)27(32)31-23(16-21-10-5-6-13-26(21)31)18-30-15-14-22(17-30)20-8-3-2-4-9-20/h2-4,7-9,11-12,19,21-23,26H,5-6,10,13-18,28H2,1H3 |
| InChIKey | ONJVQVXJOFOWRT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |