C26H31IN8O2 — CID 67177693
1-[4-[4-(3-ethylmorpholin-4-yl)-7-pyrimidin-2-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]phenyl]-3-(1-iodoethyl)urea (PubChem CID 67177693) has the molecular formula C26H31IN8O2 and a molecular weight of 614.49 g/mol. Its IUPAC name is 1-[4-[4-(3-ethylmorpholin-4-yl)-7-pyrimidin-2-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]phenyl]-3-(1-iodoethyl)urea.
| Compound Name | 1-[4-[4-(3-ethylmorpholin-4-yl)-7-pyrimidin-2-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]phenyl]-3-(1-iodoethyl)urea |
|---|---|
| PubChem CID | 67177693 |
| Molecular Formula | C26H31IN8O2 |
| Molecular Weight | 614.49 g/mol |
| Exact Mass | 614.16 |
| IUPAC Name | 1-[4-[4-(3-ethylmorpholin-4-yl)-7-pyrimidin-2-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]phenyl]-3-(1-iodoethyl)urea |
| SMILES | CCC1COCCN1c1nc(-c2ccc(NC(=O)NC(C)I)cc2)nc2c1CCN(c1ncccn1)C2 |
| InChI | InChI=1S/C26H31IN8O2/c1-3-20-16-37-14-13-35(20)24-21-9-12-34(25-28-10-4-11-29-25)15-22(21)32-23(33-24)18-5-7-19(8-6-18)31-26(36)30-17(2)27/h4-8,10-11,17,20H,3,9,12-16H2,1-2H3,(H2,30,31,36) |
| InChIKey | KFLDQFMESMSGOT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 108.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|