C19H24O3 — CID 67177746
5-(oxolan-3-yl)-2-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione (PubChem CID 67177746) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 5-(oxolan-3-yl)-2-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione.
| Compound Name | 5-(oxolan-3-yl)-2-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 67177746 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 5-(oxolan-3-yl)-2-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(C3CCOC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C19H24O3/c1-11-6-12(2)18(13(3)7-11)19-16(20)8-15(9-17(19)21)14-4-5-22-10-14/h6-7,14-15,19H,4-5,8-10H2,1-3H3 |
| InChIKey | MSIIGIPIRADESI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|