C26H30N6O2 — CID 67178347
6-[4-[(10aR)-4-[(3S)-3-methylmorpholin-4-yl]-5,6,8,9,10,10a-hexahydropyrimido[5,4-g]indolizin-2-yl]anilino]-1H-pyridin-2-one (PubChem CID 67178347) has the molecular formula C26H30N6O2 and a molecular weight of 458.57 g/mol. Its IUPAC name is 6-[4-[(10aR)-4-[(3S)-3-methylmorpholin-4-yl]-5,6,8,9,10,10a-hexahydropyrimido[5,4-g]indolizin-2-yl]anilino]-1H-pyridin-2-one.
| Compound Name | 6-[4-[(10aR)-4-[(3S)-3-methylmorpholin-4-yl]-5,6,8,9,10,10a-hexahydropyrimido[5,4-g]indolizin-2-yl]anilino]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 67178347 |
| Molecular Formula | C26H30N6O2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 6-[4-[(10aR)-4-[(3S)-3-methylmorpholin-4-yl]-5,6,8,9,10,10a-hexahydropyrimido[5,4-g]indolizin-2-yl]anilino]-1H-pyridin-2-one |
| SMILES | C[C@H]1COCCN1c1nc(-c2ccc(Nc3cccc(=O)[nH]3)cc2)nc2c1CCN1CCC[C@H]21 |
| InChI | InChI=1S/C26H30N6O2/c1-17-16-34-15-14-32(17)26-20-11-13-31-12-3-4-21(31)24(20)29-25(30-26)18-7-9-19(10-8-18)27-22-5-2-6-23(33)28-22/h2,5-10,17,21H,3-4,11-16H2,1H3,(H2,27,28,33)/t17-,21+/m0/s1 |
| InChIKey | SJYYLFPZFXPYDO-LAUBAEHRSA-N |
| XLogP | 3.49 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |