About 4-cycloheptyloxyphenol
4-cycloheptyloxyphenol (PubChem CID 67178425) has the molecular formula C13H18O2
and a molecular weight of 206.29 g/mol. Its IUPAC name is 4-cycloheptyloxyphenol.
Molecular Properties
| Compound Name | 4-cycloheptyloxyphenol |
| PubChem CID | 67178425 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 4-cycloheptyloxyphenol |
| SMILES | Oc1ccc(OC2CCCCCC2)cc1 |
| InChI | InChI=1S/C13H18O2/c14-11-7-9-13(10-8-11)15-12-5-3-1-2-4-6-12/h7-10,12,14H,1-6H2 |
| InChIKey | NTTLGFBHTKUAAI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cycloheptyloxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cycloheptyloxyphenol?
The IUPAC name of 4-cycloheptyloxyphenol (CID 67178425) is 4-cycloheptyloxyphenol.
What is the SMILES notation for 4-cycloheptyloxyphenol?
The canonical SMILES for 4-cycloheptyloxyphenol is Oc1ccc(OC2CCCCCC2)cc1.
What is the InChIKey of 4-cycloheptyloxyphenol?
The InChIKey is NTTLGFBHTKUAAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c14-11-7-9-13(10-8-11)15-12-5-3-1-2-4-6-12/h7-10,12,14H,1-6H2.
What are the key properties of 4-cycloheptyloxyphenol?
4-cycloheptyloxyphenol has a molecular weight of 206.29 g/mol, XLogP of 3.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cycloheptyloxyphenol is sourced from PubChem (CID 67178425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).