C24H28ClFN4O3 — CID 67178733
7-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;hydrochloride (PubChem CID 67178733) has the molecular formula C24H28ClFN4O3 and a molecular weight of 474.96 g/mol. Its IUPAC name is 7-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;hydrochloride.
| Compound Name | 7-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;hydrochloride |
|---|---|
| PubChem CID | 67178733 |
| Molecular Formula | C24H28ClFN4O3 |
| Molecular Weight | 474.96 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 7-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;hydrochloride |
| SMILES | Cl.O=C1CCc2ccc(OCCCCN3CCN(c4noc5cc(F)ccc45)CC3)cc2N1 |
| InChI | InChI=1S/C24H27FN4O3.ClH/c25-18-5-7-20-22(15-18)32-27-24(20)29-12-10-28(11-13-29)9-1-2-14-31-19-6-3-17-4-8-23(30)26-21(17)16-19;/h3,5-7,15-16H,1-2,4,8-14H2,(H,26,30);1H |
| InChIKey | QTJWBXOEVRXSCI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.96 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|