C22H36O3 — CID 67178943
1-phenylpentadecan-7-yl hydrogen carbonate (PubChem CID 67178943) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is 1-phenylpentadecan-7-yl hydrogen carbonate.
| Compound Name | 1-phenylpentadecan-7-yl hydrogen carbonate |
|---|---|
| PubChem CID | 67178943 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | 1-phenylpentadecan-7-yl hydrogen carbonate |
| SMILES | CCCCCCCCC(CCCCCCc1ccccc1)OC(=O)O |
| InChI | InChI=1S/C22H36O3/c1-2-3-4-5-6-13-18-21(25-22(23)24)19-14-8-7-10-15-20-16-11-9-12-17-20/h9,11-12,16-17,21H,2-8,10,13-15,18-19H2,1H3,(H,23,24) |
| InChIKey | MGVSFQCUBHCOGO-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|