About 7-phenyldodecyl hydrogen carbonate
7-phenyldodecyl hydrogen carbonate (PubChem CID 67181032) has the molecular formula C19H30O3
and a molecular weight of 306.45 g/mol. Its IUPAC name is 7-phenyldodecyl hydrogen carbonate.
Molecular Properties
| Compound Name | 7-phenyldodecyl hydrogen carbonate |
| PubChem CID | 67181032 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 7-phenyldodecyl hydrogen carbonate |
| SMILES | CCCCCC(CCCCCCOC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C19H30O3/c1-2-3-7-12-17(18-14-9-6-10-15-18)13-8-4-5-11-16-22-19(20)21/h6,9-10,14-15,17H,2-5,7-8,11-13,16H2,1H3,(H,20,21) |
| InChIKey | OBYHBINJRMDKDB-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-phenyldodecyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenyldodecyl hydrogen carbonate?
The IUPAC name of 7-phenyldodecyl hydrogen carbonate (CID 67181032) is 7-phenyldodecyl hydrogen carbonate.
What is the SMILES notation for 7-phenyldodecyl hydrogen carbonate?
The canonical SMILES for 7-phenyldodecyl hydrogen carbonate is CCCCCC(CCCCCCOC(=O)O)c1ccccc1.
What is the InChIKey of 7-phenyldodecyl hydrogen carbonate?
The InChIKey is OBYHBINJRMDKDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O3/c1-2-3-7-12-17(18-14-9-6-10-15-18)13-8-4-5-11-16-22-19(20)21/h6,9-10,14-15,17H,2-5,7-8,11-13,16H2,1H3,(H,20,21).
What are the key properties of 7-phenyldodecyl hydrogen carbonate?
7-phenyldodecyl hydrogen carbonate has a molecular weight of 306.45 g/mol, XLogP of 6.00, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenyldodecyl hydrogen carbonate is sourced from PubChem (CID 67181032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).