About 1-azatricyclo[3.3.1.13,7]decan-4-yl 5-pyridin-4-ylpyridine-3-carboxylate
1-azatricyclo[3.3.1.13,7]decan-4-yl 5-pyridin-4-ylpyridine-3-carboxylate (PubChem CID 67181346) has the molecular formula C20H21N3O2
and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-azatricyclo[3.3.1.13,7]decan-4-yl 5-pyridin-4-ylpyridine-3-carboxylate.
Molecular Properties
| Compound Name | 1-azatricyclo[3.3.1.13,7]decan-4-yl 5-pyridin-4-ylpyridine-3-carboxylate |
| PubChem CID | 67181346 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-azatricyclo[3.3.1.13,7]decan-4-yl 5-pyridin-4-ylpyridine-3-carboxylate |
| SMILES | O=C(OC1C2CC3CC1CN(C3)C2)c1cncc(-c2ccncc2)c1 |
| InChI | InChI=1S/C20H21N3O2/c24-20(16-7-15(8-22-9-16)14-1-3-21-4-2-14)25-19-17-5-13-6-18(19)12-23(10-13)11-17/h1-4,7-9,13,17-19H,5-6,10-12H2 |
| InChIKey | XHKZNKMIWQXICT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-azatricyclo[3.3.1.13,7]decan-4-yl 5-pyridin-4-ylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azatricyclo[3.3.1.13,7]decan-4-yl 5-pyridin-4-ylpyridine-3-carboxylate?
The IUPAC name of 1-azatricyclo[3.3.1.13,7]decan-4-yl 5-pyridin-4-ylpyridine-3-carboxylate (CID 67181346) is 1-azatricyclo[3.3.1.13,7]decan-4-yl 5-pyridin-4-ylpyridine-3-carboxylate.
What is the SMILES notation for 1-azatricyclo[3.3.1.13,7]decan-4-yl 5-pyridin-4-ylpyridine-3-carboxylate?
The canonical SMILES for 1-azatricyclo[3.3.1.13,7]decan-4-yl 5-pyridin-4-ylpyridine-3-carboxylate is O=C(OC1C2CC3CC1CN(C3)C2)c1cncc(-c2ccncc2)c1.
What is the InChIKey of 1-azatricyclo[3.3.1.13,7]decan-4-yl 5-pyridin-4-ylpyridine-3-carboxylate?
The InChIKey is XHKZNKMIWQXICT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O2/c24-20(16-7-15(8-22-9-16)14-1-3-21-4-2-14)25-19-17-5-13-6-18(19)12-23(10-13)11-17/h1-4,7-9,13,17-19H,5-6,10-12H2.
What are the key properties of 1-azatricyclo[3.3.1.13,7]decan-4-yl 5-pyridin-4-ylpyridine-3-carboxylate?
1-azatricyclo[3.3.1.13,7]decan-4-yl 5-pyridin-4-ylpyridine-3-carboxylate has a molecular weight of 335.41 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azatricyclo[3.3.1.13,7]decan-4-yl 5-pyridin-4-ylpyridine-3-carboxylate is sourced from PubChem (CID 67181346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).