C32H30FNO5 — CID 67181857
2-[2-[(3aR,5R,6R,6aR)-5-[2-[4-(3-fluoro-4-methylphenyl)phenyl]ethenyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethyl]isoindole-1,3-dione (PubChem CID 67181857) has the molecular formula C32H30FNO5 and a molecular weight of 527.59 g/mol. Its IUPAC name is 2-[2-[(3aR,5R,6R,6aR)-5-[2-[4-(3-fluoro-4-methylphenyl)phenyl]ethenyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(3aR,5R,6R,6aR)-5-[2-[4-(3-fluoro-4-methylphenyl)phenyl]ethenyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67181857 |
| Molecular Formula | C32H30FNO5 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 2-[2-[(3aR,5R,6R,6aR)-5-[2-[4-(3-fluoro-4-methylphenyl)phenyl]ethenyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(-c2ccc(C=C[C@H]3O[C@@H]4OC(C)(C)O[C@@H]4[C@@H]3CCN3C(=O)c4ccccc4C3=O)cc2)cc1F |
| InChI | InChI=1S/C32H30FNO5/c1-19-8-12-22(18-26(19)33)21-13-9-20(10-14-21)11-15-27-25(28-31(37-27)39-32(2,3)38-28)16-17-34-29(35)23-6-4-5-7-24(23)30(34)36/h4-15,18,25,27-28,31H,16-17H2,1-3H3/t25-,27-,28-,31-/m1/s1 |
| InChIKey | KASGDWYCCAWWBT-QWOIFIOOSA-N |
| XLogP | 5.99 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|