About azane;2-ethyl-1H-pyrazolo[1,5-a]pyridin-2-amine
azane;2-ethyl-1H-pyrazolo[1,5-a]pyridin-2-amine (PubChem CID 67182046) has the molecular formula C9H16N4
and a molecular weight of 180.25 g/mol. Its IUPAC name is azane;2-ethyl-1H-pyrazolo[1,5-a]pyridin-2-amine.
Molecular Properties
| Compound Name | azane;2-ethyl-1H-pyrazolo[1,5-a]pyridin-2-amine |
| PubChem CID | 67182046 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | azane;2-ethyl-1H-pyrazolo[1,5-a]pyridin-2-amine |
| SMILES | CCC1(N)C=C2C=CC=CN2N1.N |
| InChI | InChI=1S/C9H13N3.H3N/c1-2-9(10)7-8-5-3-4-6-12(8)11-9;/h3-7,11H,2,10H2,1H3;1H3 |
| InChIKey | XUBCTJFSKWKDLR-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;2-ethyl-1H-pyrazolo[1,5-a]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-ethyl-1H-pyrazolo[1,5-a]pyridin-2-amine?
The IUPAC name of azane;2-ethyl-1H-pyrazolo[1,5-a]pyridin-2-amine (CID 67182046) is azane;2-ethyl-1H-pyrazolo[1,5-a]pyridin-2-amine.
What is the SMILES notation for azane;2-ethyl-1H-pyrazolo[1,5-a]pyridin-2-amine?
The canonical SMILES for azane;2-ethyl-1H-pyrazolo[1,5-a]pyridin-2-amine is CCC1(N)C=C2C=CC=CN2N1.N.
What is the InChIKey of azane;2-ethyl-1H-pyrazolo[1,5-a]pyridin-2-amine?
The InChIKey is XUBCTJFSKWKDLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3.H3N/c1-2-9(10)7-8-5-3-4-6-12(8)11-9;/h3-7,11H,2,10H2,1H3;1H3.
What are the key properties of azane;2-ethyl-1H-pyrazolo[1,5-a]pyridin-2-amine?
azane;2-ethyl-1H-pyrazolo[1,5-a]pyridin-2-amine has a molecular weight of 180.25 g/mol, XLogP of 1.00, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-ethyl-1H-pyrazolo[1,5-a]pyridin-2-amine is sourced from PubChem (CID 67182046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).