C28H38O6Si — CID 67182141
ethyl 2-[(3aS,5R,6S,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate (PubChem CID 67182141) has the molecular formula C28H38O6Si and a molecular weight of 498.69 g/mol. Its IUPAC name is ethyl 2-[(3aS,5R,6S,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate.
| Compound Name | ethyl 2-[(3aS,5R,6S,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate |
|---|---|
| PubChem CID | 67182141 |
| Molecular Formula | C28H38O6Si |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | ethyl 2-[(3aS,5R,6S,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1[C@@H]2OC(C)(C)O[C@@H]2O[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H38O6Si/c1-7-30-24(29)18-22-23(32-26-25(22)33-28(5,6)34-26)19-31-35(27(2,3)4,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-17,22-23,25-26H,7,18-19H2,1-6H3/t22-,23-,25-,26-/m0/s1 |
| InChIKey | QXGYVPVQCPEJTI-LCGRTSHQSA-N |
| XLogP | 4.01 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|