About (1R)-1-[5-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethanamine;dihydrochloride
(1R)-1-[5-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethanamine;dihydrochloride (PubChem CID 67182181) has the molecular formula C8H14Cl2F3N3
and a molecular weight of 280.12 g/mol. Its IUPAC name is (1R)-1-[5-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethanamine;dihydrochloride.
Molecular Properties
| Compound Name | (1R)-1-[5-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethanamine;dihydrochloride |
| PubChem CID | 67182181 |
| Molecular Formula | C8H14Cl2F3N3 |
| Molecular Weight | 280.12 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | (1R)-1-[5-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethanamine;dihydrochloride |
| SMILES | Cc1c([C@@H](C)N)cnn1CC(F)(F)F.Cl.Cl |
| InChI | InChI=1S/C8H12F3N3.2ClH/c1-5(12)7-3-13-14(6(7)2)4-8(9,10)11;;/h3,5H,4,12H2,1-2H3;2*1H/t5-;;/m1../s1 |
| InChIKey | XRGMJWDZVTZAHZ-ZJIMSODOSA-N |
| XLogP | 2.62 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.12 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-1-[5-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[5-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethanamine;dihydrochloride?
The IUPAC name of (1R)-1-[5-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethanamine;dihydrochloride (CID 67182181) is (1R)-1-[5-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethanamine;dihydrochloride.
What is the SMILES notation for (1R)-1-[5-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethanamine;dihydrochloride?
The canonical SMILES for (1R)-1-[5-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethanamine;dihydrochloride is Cc1c([C@@H](C)N)cnn1CC(F)(F)F.Cl.Cl.
What is the InChIKey of (1R)-1-[5-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethanamine;dihydrochloride?
The InChIKey is XRGMJWDZVTZAHZ-ZJIMSODOSA-N. The full InChI is InChI=1S/C8H12F3N3.2ClH/c1-5(12)7-3-13-14(6(7)2)4-8(9,10)11;;/h3,5H,4,12H2,1-2H3;2*1H/t5-;;/m1../s1.
What are the key properties of (1R)-1-[5-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethanamine;dihydrochloride?
(1R)-1-[5-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethanamine;dihydrochloride has a molecular weight of 280.12 g/mol, XLogP of 2.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[5-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethanamine;dihydrochloride is sourced from PubChem (CID 67182181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).